CAS 136237-67-7 appears in our catalog under these names: trans-Methyl 2-aminocyclopentanecarboxylate hydrochloride, 98+%, trans-Methyl 2-aminocyclopentanecarboxylate hydrochloride, 95%, 95%, trans-Methyl 2-aminocyclopentanecarboxylate hydrochloride, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 50mg, 100mg, 250mg, 500mg, 1g.
Trans-methyl (1R,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 136237-67-7) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-methyl (1R,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: KXQFCNYQRWIKML-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-methyl (1R,2R)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | KXQFCNYQRWIKML-KGZKBUQUSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@H]1N.Cl |
Computed by PubChem (NCBI)