CAS 380227-38-3 is the registry number for (1R,2S)-Methyl 2-aminocyclopentanecarboxylate hydrochloride, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-methyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 380227-38-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-methyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: KXQFCNYQRWIKML-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-methyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | KXQFCNYQRWIKML-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)