CAS 120035-90-7 is the registry number for 5-(4-Hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(4-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one (CAS 120035-90-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 5-(4-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: WAVMOUMHFJLVIA-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | WAVMOUMHFJLVIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)O2)O |
Computed by PubChem (NCBI)