CAS 1200497-77-3 is the registry number for 3-Chloro-5-(ethoxycarbonyl)-pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-chloro-5-ethoxycarbonylpyridine-2-carboxylic acid (CAS 1200497-77-3) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 3-chloro-5-ethoxycarbonylpyridine-2-carboxylic acid. InChIKey: ZPFBWRGNNLLCMD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 3-chloro-5-ethoxycarbonylpyridine-2-carboxylic acid |
| InChIKey | ZPFBWRGNNLLCMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)