Products 1203578-61-3
CAS 1203578-61-3 is the registry number for 3-(Isoquinolin-5-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-isoquinolin-5-ylpropanoic acid;hydrochloride (CAS 1203578-61-3) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 3-isoquinolin-5-ylpropanoic acid;hydrochloride. InChIKey: MKGMYQVIRYWLAF-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 3-isoquinolin-5-ylpropanoic acid;hydrochloride |
| InChIKey | MKGMYQVIRYWLAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)CCC(=O)O.Cl |
Computed by PubChem (NCBI)