CAS 2059954-91-3 appears in our catalog under these names: 6-Chloro-1h-spiro[indole-3,4'-oxane]-2-one, 95%, 6-Chloro-1h-spiro(indole-3,4'-oxane)-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
6-chlorospiro[1H-indole-3,4'-oxane]-2-one (CAS 2059954-91-3) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 6-chlorospiro[1H-indole-3,4'-oxane]-2-one. InChIKey: NVECDWKAASRMMO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 6-chlorospiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | NVECDWKAASRMMO-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C=C(C=C3)Cl)NC2=O |
Computed by PubChem (NCBI)