Products 1204298-46-3
CAS 1204298-46-3 is the registry number for 1-Benzyl-6-sulfanyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-benzyl-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1204298-46-3) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: 1-benzyl-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: ZSUNRRTZKNVOAM-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-benzyl-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | ZSUNRRTZKNVOAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=N2)C(=O)NC(=S)N3 |
Computed by PubChem (NCBI)