Products 1205-58-9
CAS 1205-58-9 appears in our catalog under these names: 4-(Acetamidomethyl)benzoic acid, 98%, 4-(Acetamidomethyl)benzoic Acid, >95% (HPLC), 4–(Acetamidomethyl)benzoic acid, 4-(Acetamidomethyl)benzoic acid 98%, 4-(Acetamidomethyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 25g, 100g, 250mg, 2.5g.
4-(acetamidomethyl)benzoic acid (CAS 1205-58-9) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 4-(acetamidomethyl)benzoic acid. InChIKey: DSEUUJNFENYHDY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4-(acetamidomethyl)benzoic acid |
| InChIKey | DSEUUJNFENYHDY-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)