Products 120686-00-2
CAS 120686-00-2 appears in our catalog under these names: Methyl 6-hydroxy-2-methoxy-7,8-dihydroquinoline-5-carboxylate, 95%, Methyl 6–hydroxy–2–methoxy–7，8–dihydroquinoline–5–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
Methyl 6-hydroxy-2-methoxy-7,8-dihydroquinoline-5-carboxylate (CAS 120686-00-2) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: methyl 6-hydroxy-2-methoxy-7,8-dihydroquinoline-5-carboxylate. InChIKey: OPTRBDFGSOAYQF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | methyl 6-hydroxy-2-methoxy-7,8-dihydroquinoline-5-carboxylate |
| InChIKey | OPTRBDFGSOAYQF-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C(=C(CC2)O)C(=O)OC |
Computed by PubChem (NCBI)