CAS 1206970-52-6 is the registry number for 2-(5-Chloro-1h-pyrrolo[3,2-b]pyridin-2-yl)benzenamine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
2-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)aniline (CAS 1206970-52-6) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 2-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)aniline. InChIKey: GBTFIASRYOSMNN-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-(5-chloro-1H-pyrrolo[3,2-b]pyridin-2-yl)aniline |
| InChIKey | GBTFIASRYOSMNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC3=C(N2)C=CC(=N3)Cl)N |
Computed by PubChem (NCBI)