CAS 120889-05-6 appears in our catalog under these names: 2-Chloro-1-methyl-6-phenyl-1H-imidazo[4,5-b]pyridine, 98%, 2-Chloro-1-methyl-6-phenylimidazo(4,5-b)pyridine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
2-chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine (CAS 120889-05-6) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 2-chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine. InChIKey: FBFVKWMIRFROSV-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine |
| InChIKey | FBFVKWMIRFROSV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=CC(=C2)C3=CC=CC=C3)N=C1Cl |
Computed by PubChem (NCBI)