CAS 2364486-23-5 appears in our catalog under these names: 3-(4-Chloropyrimidin-2-yl)-1-methyl-1H-indole, 3-(4-Chloropyrimidin-2-yl)-1-methyl-1H-indole, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 5mg, 1g, 100mg, 250mg.
3-(4-chloropyrimidin-2-yl)-1-methylindole (CAS 2364486-23-5) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 3-(4-chloropyrimidin-2-yl)-1-methylindole. InChIKey: GPGHXIZAFSFZBP-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-(4-chloropyrimidin-2-yl)-1-methylindole |
| InChIKey | GPGHXIZAFSFZBP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC=CC(=N3)Cl |
Computed by PubChem (NCBI)