CAS 439110-86-8 appears in our catalog under these names: 3-(6-Chloro-imidazo[1,2-a]pyridin-2-yl)-phenylamine, 95%, 3-(6-Chloroimidazo(1,2-a)pyridin-2-yl)aniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(6-chloroimidazo[1,2-a]pyridin-2-yl)aniline (CAS 439110-86-8) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 3-(6-chloroimidazo[1,2-a]pyridin-2-yl)aniline. InChIKey: DGRUBXTUPVOPAI-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-(6-chloroimidazo[1,2-a]pyridin-2-yl)aniline |
| InChIKey | DGRUBXTUPVOPAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CN3C=C(C=CC3=N2)Cl |
Computed by PubChem (NCBI)