CAS 34164-94-8 is the registry number for 2-(4-Chlorophenyl)imidazo[1,2-a]pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-amine (CAS 34164-94-8) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-amine. InChIKey: JBULXFBOAPDPFC-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-amine |
| InChIKey | JBULXFBOAPDPFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)