CAS 58347-51-6 is the registry number for 7-Chloro-5-methyl-3-phenylpyrazolo(1,5-a)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
7-chloro-5-methyl-3-phenylpyrazolo[1,5-a]pyrimidine (CAS 58347-51-6) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 7-chloro-5-methyl-3-phenylpyrazolo[1,5-a]pyrimidine. InChIKey: FXUFOVCCNAEZHK-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 7-chloro-5-methyl-3-phenylpyrazolo[1,5-a]pyrimidine |
| InChIKey | FXUFOVCCNAEZHK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C(=C1)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)