CAS 1207-62-1 is the registry number for N-(METHYLSULFONYL)-N-PHENYLMETHANESULFONAMIDE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-methylsulfonyl-N-phenylmethanesulfonamide (CAS 1207-62-1) is a chemical compound with the molecular formula C8H11NO4S2 and a molecular weight of 249.3 g/mol. IUPAC name: N-methylsulfonyl-N-phenylmethanesulfonamide. InChIKey: IADJFFRYWBYPAR-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S2 |
|---|---|
| Molecular weight | 249.3 g/mol |
| IUPAC name | N-methylsulfonyl-N-phenylmethanesulfonamide |
| InChIKey | IADJFFRYWBYPAR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(C1=CC=CC=C1)S(=O)(=O)C |
Computed by PubChem (NCBI)