CAS 51859-12-2 is the registry number for 3,5-Bis(methylsulfonyl)aniline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
3,5-bis(methylsulfonyl)aniline (CAS 51859-12-2) is a chemical compound with the molecular formula C8H11NO4S2 and a molecular weight of 249.3 g/mol. IUPAC name: 3,5-bis(methylsulfonyl)aniline. InChIKey: DLJOVNXLPVHDMZ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S2 |
|---|---|
| Molecular weight | 249.3 g/mol |
| IUPAC name | 3,5-bis(methylsulfonyl)aniline |
| InChIKey | DLJOVNXLPVHDMZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)N)S(=O)(=O)C |
Computed by PubChem (NCBI)