Products 2828551-20-6

CAS 2828551-20-6 is the registry number for 5-(2-(Methylsulfonyl)propan-2-yl)isothiazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(2-methylsulfonylpropan-2-yl)-1,2-thiazole-3-carboxylic acid (CAS 2828551-20-6) is a chemical compound with the molecular formula C8H11NO4S2 and a molecular weight of 249.3 g/mol. IUPAC name: 5-(2-methylsulfonylpropan-2-yl)-1,2-thiazole-3-carboxylic acid. InChIKey: RLSANVIKDJDWEW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO4S2
Molecular weight249.3 g/mol
IUPAC name5-(2-methylsulfonylpropan-2-yl)-1,2-thiazole-3-carboxylic acid
InChIKeyRLSANVIKDJDWEW-UHFFFAOYSA-N
SMILESCC(C)(C1=CC(=NS1)C(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)