Products 893782-22-4
CAS 893782-22-4 is the registry number for 4-(N-Ethyl-N-methylsulfamoyl)thiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylic acid (CAS 893782-22-4) is a chemical compound with the molecular formula C8H11NO4S2 and a molecular weight of 249.3 g/mol. IUPAC name: 4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylic acid. InChIKey: ZMMKSSMRHFLZOL-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S2 |
|---|---|
| Molecular weight | 249.3 g/mol |
| IUPAC name | 4-[ethyl(methyl)sulfamoyl]thiophene-2-carboxylic acid |
| InChIKey | ZMMKSSMRHFLZOL-UHFFFAOYSA-N |
| SMILES | CCN(C)S(=O)(=O)C1=CSC(=C1)C(=O)O |
Computed by PubChem (NCBI)