Products 2120046-62-8
CAS 2120046-62-8 is the registry number for Ethyl 2-(ethylsulfonyl)thiazole-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-ethylsulfonyl-1,3-thiazole-5-carboxylate (CAS 2120046-62-8) is a chemical compound with the molecular formula C8H11NO4S2 and a molecular weight of 249.3 g/mol. IUPAC name: ethyl 2-ethylsulfonyl-1,3-thiazole-5-carboxylate. InChIKey: PCSBLXCCCDWEQM-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S2 |
|---|---|
| Molecular weight | 249.3 g/mol |
| IUPAC name | ethyl 2-ethylsulfonyl-1,3-thiazole-5-carboxylate |
| InChIKey | PCSBLXCCCDWEQM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(S1)S(=O)(=O)CC |
Computed by PubChem (NCBI)