Products 160550-67-4
CAS 160550-67-4 is the registry number for (R)-Erdosteine. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-oxo-2-[[(3R)-2-oxothiolan-3-yl]amino]ethyl]sulfanylacetic acid (CAS 160550-67-4) is a chemical compound with the molecular formula C8H11NO4S2 and a molecular weight of 249.3 g/mol. IUPAC name: 2-[2-oxo-2-[[(3R)-2-oxothiolan-3-yl]amino]ethyl]sulfanylacetic acid. InChIKey: QGFORSXNKQLDNO-RXMQYKEDSA-N.
| Molecular formula | C8H11NO4S2 |
|---|---|
| Molecular weight | 249.3 g/mol |
| IUPAC name | 2-[2-oxo-2-[[(3R)-2-oxothiolan-3-yl]amino]ethyl]sulfanylacetic acid |
| InChIKey | QGFORSXNKQLDNO-RXMQYKEDSA-N |
| SMILES | C1CSC(=O)[C@@H]1NC(=O)CSCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-Erdosteine