CAS 1207060-56-7 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-2,3-dimethylbutanoic acid, 95%, (R)–2–((tert–Butoxycarbonyl)amino)–2,3–dimethylbutanoic acid, (R)-2-((tert-Butoxycarbonyl)amino)-2,3-dimethylbutanoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(2R)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1207060-56-7) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2R)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: MXPBQQXWXZWBMK-LLVKDONJSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2R)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | MXPBQQXWXZWBMK-LLVKDONJSA-N |
| SMILES | CC(C)[C@](C)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)