Products 139938-00-4

CAS 139938-00-4 appears in our catalog under these names: Boc–α–Me–DL–Val–OH, 2-((tert-Butoxycarbonyl)amino)-2,3-dimethylbutanoic acid, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 139938-00-4) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: MXPBQQXWXZWBMK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO4
Molecular weight231.29 g/mol
IUPAC name2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyMXPBQQXWXZWBMK-UHFFFAOYSA-N
SMILESCC(C)C(C)(C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)