CAS 1208082-34-1 is the registry number for 7-Chloroimidazo[1,2-c]pyrimidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloroimidazo[1,2-c]pyrimidine-2-carboxylic acid (CAS 1208082-34-1) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloroimidazo[1,2-c]pyrimidine-2-carboxylic acid. InChIKey: ACXLJDRHYMNMLI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloroimidazo[1,2-c]pyrimidine-2-carboxylic acid |
| InChIKey | ACXLJDRHYMNMLI-UHFFFAOYSA-N |
| SMILES | C1=C(N=CN2C1=NC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)