CAS 120809-05-4 is the registry number for 2,7-Dimethoxy-9-acridinone. Offered by: TRC. Available pack sizes: 5g.
2,7-dimethoxy-10H-acridin-9-one (CAS 120809-05-4) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 2,7-dimethoxy-10H-acridin-9-one. InChIKey: LRCYXJSQZFOQKS-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 2,7-dimethoxy-10H-acridin-9-one |
| InChIKey | LRCYXJSQZFOQKS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C(C2=O)C=C(C=C3)OC |
Computed by PubChem (NCBI)