Products 120887-54-9
CAS 120887-54-9 is the registry number for Benzyl L-histidinate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate;hydrochloride (CAS 120887-54-9) is a chemical compound with the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate;hydrochloride. InChIKey: FRJRDAPZBUIVLH-YDALLXLXSA-N.
| Molecular formula | C13H16ClN3O2 |
|---|---|
| Molecular weight | 281.74 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate;hydrochloride |
| InChIKey | FRJRDAPZBUIVLH-YDALLXLXSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CN=CN2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzyl L-histidinate hydrochloride