CAS 1795304-53-8 is the registry number for Ethyl 1-(3-(aminomethyl)phenyl)-1H-pyrazole-3-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 1-[3-(aminomethyl)phenyl]pyrazole-3-carboxylate;hydrochloride (CAS 1795304-53-8) is a chemical compound with the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. IUPAC name: ethyl 1-[3-(aminomethyl)phenyl]pyrazole-3-carboxylate;hydrochloride. InChIKey: JKKOKYGATNVGMR-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O2 |
|---|---|
| Molecular weight | 281.74 g/mol |
| IUPAC name | ethyl 1-[3-(aminomethyl)phenyl]pyrazole-3-carboxylate;hydrochloride |
| InChIKey | JKKOKYGATNVGMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)