CAS 2242625-36-9 appears in our catalog under these names: Palbociclib Impurity 61, Palbociclib Impurity 71, 3-(2-Chloro-4-(cyclopentylamino)pyrimidin-5-yl)but-2-enoic acid, 98%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
(E)-3-[2-chloro-4-(cyclopentylamino)pyrimidin-5-yl]but-2-enoic acid (CAS 2242625-36-9) is a chemical compound with the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. IUPAC name: (E)-3-[2-chloro-4-(cyclopentylamino)pyrimidin-5-yl]but-2-enoic acid. InChIKey: JYFDYAZUWPKGFU-SOFGYWHQSA-N.
| Molecular formula | C13H16ClN3O2 |
|---|---|
| Molecular weight | 281.74 g/mol |
| IUPAC name | (E)-3-[2-chloro-4-(cyclopentylamino)pyrimidin-5-yl]but-2-enoic acid |
| InChIKey | JYFDYAZUWPKGFU-SOFGYWHQSA-N |
| SMILES | C/C(=C\C(=O)O)/C1=CN=C(N=C1NC2CCCC2)Cl |
Computed by PubChem (NCBI)