CAS 400869-55-8 is the registry number for 3-(3-Chloro-1H-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(3-chloro-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid (CAS 400869-55-8) is a chemical compound with the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. IUPAC name: 3-(3-chloro-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid. InChIKey: SEWAAGVSSSBDQV-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O2 |
|---|---|
| Molecular weight | 281.74 g/mol |
| IUPAC name | 3-(3-chloro-1,2,4-triazol-1-yl)adamantane-1-carboxylic acid |
| InChIKey | SEWAAGVSSSBDQV-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N4C=NC(=N4)Cl)C(=O)O |
Computed by PubChem (NCBI)