CAS 1414864-04-2 is the registry number for tert-Butyl ((6-chloroimidazo[1,2-a]pyridin-5-yl)methyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl N-[(6-chloroimidazo[1,2-a]pyridin-5-yl)methyl]carbamate (CAS 1414864-04-2) is a chemical compound with the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. IUPAC name: tert-butyl N-[(6-chloroimidazo[1,2-a]pyridin-5-yl)methyl]carbamate. InChIKey: ZPLYIKUZAWDDQP-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O2 |
|---|---|
| Molecular weight | 281.74 g/mol |
| IUPAC name | tert-butyl N-[(6-chloroimidazo[1,2-a]pyridin-5-yl)methyl]carbamate |
| InChIKey | ZPLYIKUZAWDDQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=CC2=NC=CN21)Cl |
Computed by PubChem (NCBI)