CAS 937597-50-7 is the registry number for 1-Butyl-5-chloro-3,6-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-butyl-5-chloro-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 937597-50-7) is a chemical compound with the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. IUPAC name: 1-butyl-5-chloro-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: KPMGDVVEIQYFBJ-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O2 |
|---|---|
| Molecular weight | 281.74 g/mol |
| IUPAC name | 1-butyl-5-chloro-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | KPMGDVVEIQYFBJ-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=NC(=C(C(=C2C(=N1)C)C(=O)O)Cl)C |
Computed by PubChem (NCBI)