Products 1209261-56-2
CAS 1209261-56-2 is the registry number for 5,7-Dihydroxy-4-methyl-3-(4-methylpiperazin-1-yl)-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5,7-dihydroxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one (CAS 1209261-56-2) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: 5,7-dihydroxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one. InChIKey: WTGPVPWURYYDMO-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 5,7-dihydroxy-4-methyl-3-(4-methylpiperazin-1-yl)chromen-2-one |
| InChIKey | WTGPVPWURYYDMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=CC(=CC(=C12)O)O)N3CCN(CC3)C |
Computed by PubChem (NCBI)