CAS 58237-94-8 appears in our catalog under these names: N-Boc-(3-indole)glycine, 95%, 2-((tert-Butoxycarbonyl)amino)-2-(1H-indol-3-yl)acetic acid, 97%, 2-{((tert-butoxy)carbonyl)amino}-2-(1H-indol-3-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
2-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 58237-94-8) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: SORQKPVCWGOPQX-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | SORQKPVCWGOPQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CNC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)