CAS 731810-56-3 appears in our catalog under these names: Methyl 6-n-boc-aminoindole-4-carboxylate, 95%, METHYL 6–N–BOC–AMINOINDOLE–4–CARBOXYLATE, Methyl 6-((tert-butoxycarbonyl),amino),-1H-indole-4-carboxylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg.
Methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-4-carboxylate (CAS 731810-56-3) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-4-carboxylate. InChIKey: RBLKRQUREUXQNK-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-indole-4-carboxylate |
| InChIKey | RBLKRQUREUXQNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C2C=CNC2=C1)C(=O)OC |
Computed by PubChem (NCBI)