Products 885266-64-8

CAS 885266-64-8 is the registry number for [4-[(tert-Butoxycarbonyl)amino]-1h-indol-1-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]indol-1-yl]acetic acid (CAS 885266-64-8) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]indol-1-yl]acetic acid. InChIKey: AOFNYIODSIXUBL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O4
Molecular weight290.31 g/mol
IUPAC name2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]indol-1-yl]acetic acid
InChIKeyAOFNYIODSIXUBL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C2C=CN(C2=CC=C1)CC(=O)O

Computed by PubChem (NCBI)