CAS 135414-03-8 appears in our catalog under these names: 2-tert-Butoxycarbonylamino-3-(4-cyano-phenyl)-propionic acid, 95%, 2-((tert-Butoxycarbonyl)amino)-3-(4-cyanophenyl)propanoic acid, 95%, 2–((tert–butoxycarbonyl)amino)–3–(4–cyanophenyl)propanoic acid, 2-((tert-Butoxycarbonyl)amino)-3-(4-cyanophenyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g.
3-(4-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 135414-03-8) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: 3-(4-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RMBLTLXJGNILPG-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 3-(4-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RMBLTLXJGNILPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)