CAS 500770-81-0 appears in our catalog under these names: Boc-(s)-3-amino-3-(3-cyano-phenyl)-propionic acid, 98%, Boc-β-Phe(3-CN)-OH 98%, (S)-3-((tert-Butoxycarbonyl)amino)-3-(3-cyanophenyl)propanoic acid, 96%, 96%, (S)-3-((tert-Butoxycarbonyl)amino)-3-(3-cyanophenyl)propanoic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
(3S)-3-(3-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500770-81-0) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: (3S)-3-(3-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QSPUAVCHVGCBGN-LBPRGKRZSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | (3S)-3-(3-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QSPUAVCHVGCBGN-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)