Products 1210419-02-5

CAS 1210419-02-5 is the registry number for 6-(Cyclohex-1-en-1-yl)-5-fluoropicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-(cyclohexen-1-yl)-5-fluoropyridine-2-carboxylic acid (CAS 1210419-02-5) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: 6-(cyclohexen-1-yl)-5-fluoropyridine-2-carboxylic acid. InChIKey: JFHPOINPEOMAGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FNO2
Molecular weight221.23 g/mol
IUPAC name6-(cyclohexen-1-yl)-5-fluoropyridine-2-carboxylic acid
InChIKeyJFHPOINPEOMAGQ-UHFFFAOYSA-N
SMILESC1CCC(=CC1)C2=C(C=CC(=N2)C(=O)O)F

Computed by PubChem (NCBI)