CAS 886362-69-2 appears in our catalog under these names: Ethyl 6-fluoro-2-methylindole-3-carboxylate, 97%, 6-Fluoro-2-methylindole-3-carboxylic acid ethyl ester, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate (CAS 886362-69-2) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate. InChIKey: GOKWPANDLYARQA-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | ethyl 6-fluoro-2-methyl-1H-indole-3-carboxylate |
| InChIKey | GOKWPANDLYARQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C1C=CC(=C2)F)C |
Computed by PubChem (NCBI)