CAS 866144-28-7 appears in our catalog under these names: 1-(4-Fluoro-benzoyl)-piperidin-4-one, 96%, 1-(4-Fluorobenzoyl)piperidin-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 500mg, 1000mg, 2000mg.
1-(4-fluorobenzoyl)piperidin-4-one (CAS 866144-28-7) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: 1-(4-fluorobenzoyl)piperidin-4-one. InChIKey: JBHMGVTZNXWWFM-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 1-(4-fluorobenzoyl)piperidin-4-one |
| InChIKey | JBHMGVTZNXWWFM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)