CAS 1391467-31-4 is the registry number for 5-Fluoro-1-propyl-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-fluoro-1-propylindole-2-carboxylic acid (CAS 1391467-31-4) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: 5-fluoro-1-propylindole-2-carboxylic acid. InChIKey: IFGJFIJKPJMHES-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 5-fluoro-1-propylindole-2-carboxylic acid |
| InChIKey | IFGJFIJKPJMHES-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=C(C=C2)F)C=C1C(=O)O |
Computed by PubChem (NCBI)