Products 886362-68-1
CAS 886362-68-1 appears in our catalog under these names: 4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester, 95%, Ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate (CAS 886362-68-1) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate. InChIKey: FFLAUZJZZHRPQM-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate |
| InChIKey | FFLAUZJZZHRPQM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C1C(=CC=C2)F)C |
Computed by PubChem (NCBI)