CAS 707541-47-7 is the registry number for 5-Fluoro-3h-spiro[isobenzofuran-1,4'-piperidin]-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one (CAS 707541-47-7) is a chemical compound with the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. IUPAC name: 6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one. InChIKey: ARKQQEOEWIQJBC-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one |
| InChIKey | ARKQQEOEWIQJBC-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=C(C=C3)F)C(=O)O2 |
Computed by PubChem (NCBI)