CAS 121049-90-9 is the registry number for cis-Dimethyl 1-benzylazetidine-2,4-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 25g, 5g.
Dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate (CAS 121049-90-9) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate. InChIKey: COJVYCMOVXNWAM-TXEJJXNPSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate |
| InChIKey | COJVYCMOVXNWAM-TXEJJXNPSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](N1CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)