CAS 121049-91-0 appears in our catalog under these names: trans-Dimethyl 1-benzylazetidine-2,4-dicarboxylate, 95%, trans–Dimethyl 1–benzylazetidine–2,4–dicarboxylate, trans-Dimethyl 1-benzylazetidine-2,4-dicarboxylate, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Dimethyl (2S,4S)-1-benzylazetidine-2,4-dicarboxylate (CAS 121049-91-0) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: dimethyl (2S,4S)-1-benzylazetidine-2,4-dicarboxylate. InChIKey: COJVYCMOVXNWAM-RYUDHWBXSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | dimethyl (2S,4S)-1-benzylazetidine-2,4-dicarboxylate |
| InChIKey | COJVYCMOVXNWAM-RYUDHWBXSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](N1CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)