CAS 1210965-70-0 is the registry number for N-((3-(Furan-2-yl)-1,2,4-oxadiazol-5-yl)methyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline (CAS 1210965-70-0) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline. InChIKey: VXAIRCTWFIZVNB-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| InChIKey | VXAIRCTWFIZVNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NCC2=NC(=NO2)C3=CC=CO3 |
Computed by PubChem (NCBI)