CAS 33786-33-3 is the registry number for Benzaldehyde 4-nitrophenylhydrazone, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
N-[(E)-benzylideneamino]-4-nitroaniline (CAS 33786-33-3) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: N-[(E)-benzylideneamino]-4-nitroaniline. InChIKey: NOIFWEYOLLHIMW-GXDHUFHOSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]-4-nitroaniline |
| InChIKey | NOIFWEYOLLHIMW-GXDHUFHOSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)