Products 929973-99-9
CAS 929973-99-9 appears in our catalog under these names: (1Z)-2-(1H-Benzimidazol-2-yl)-1-(2-furyl)ethanone oxime, 95%, N-(2-(1H-1,3-Benzodiazol-2-yl)-1-(furan-2-yl)ethylidene)hydroxylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(NZ)-N-[2-(1H-benzimidazol-2-yl)-1-(furan-2-yl)ethylidene]hydroxylamine (CAS 929973-99-9) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: (NZ)-N-[2-(1H-benzimidazol-2-yl)-1-(furan-2-yl)ethylidene]hydroxylamine. InChIKey: FHEQCGZTZCRMLB-WJDWOHSUSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (NZ)-N-[2-(1H-benzimidazol-2-yl)-1-(furan-2-yl)ethylidene]hydroxylamine |
| InChIKey | FHEQCGZTZCRMLB-WJDWOHSUSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C/C(=N/O)/C3=CC=CO3 |
Computed by PubChem (NCBI)