CAS 121751-71-1 is the registry number for 2-[2-(Pyrazol-1-yl)ethyl]isoindole-1,3-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione (CAS 121751-71-1) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: 2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione. InChIKey: HJJKOBITSBBKBP-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-(2-pyrazol-1-ylethyl)isoindole-1,3-dione |
| InChIKey | HJJKOBITSBBKBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCN3C=CC=N3 |
Computed by PubChem (NCBI)