CAS 879590-14-4 is the registry number for (2-Methoxy-5-[1,3]oxazolo[4,5-b]pyridin-2-ylphenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline (CAS 879590-14-4) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: 2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline. InChIKey: BQYWCWWCDXAMOP-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
| InChIKey | BQYWCWWCDXAMOP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=C(O2)C=CC=N3)N |
Computed by PubChem (NCBI)